CAS 50666-75-6 is the registry number for N-(2,6-Dimethylphenyl)-2-iodoacetamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,6-dimethylphenyl)-2-iodoacetamide (CAS 50666-75-6) is a chemical compound with the molecular formula C10H12INO and a molecular weight of 289.11 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2-iodoacetamide. InChIKey: WYMMKVRDDGLTEG-UHFFFAOYSA-N.
| Molecular formula | C10H12INO |
|---|---|
| Molecular weight | 289.11 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2-iodoacetamide |
| InChIKey | WYMMKVRDDGLTEG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CI |
Computed by PubChem (NCBI)