Products 333349-52-3

CAS 333349-52-3 is the registry number for 2-Iodo-N-propylbenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

2-iodo-N-propylbenzamide (CAS 333349-52-3) is a chemical compound with the molecular formula C10H12INO and a molecular weight of 289.11 g/mol. IUPAC name: 2-iodo-N-propylbenzamide. InChIKey: LKHDFYFCROINHM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12INO
Molecular weight289.11 g/mol
IUPAC name2-iodo-N-propylbenzamide
InChIKeyLKHDFYFCROINHM-UHFFFAOYSA-N
SMILESCCCNC(=O)C1=CC=CC=C1I

Computed by PubChem (NCBI)