CAS 1228784-41-5 is the registry number for 1-Difluoromethanesulfonyl-2-fluorobenzene. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(difluoromethylsulfonyl)-2-fluorobenzene (CAS 1228784-41-5) is a chemical compound with the molecular formula C7H5F3O2S and a molecular weight of 210.18 g/mol. IUPAC name: 1-(difluoromethylsulfonyl)-2-fluorobenzene. InChIKey: FHJHSNGZQYRXDX-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O2S |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 1-(difluoromethylsulfonyl)-2-fluorobenzene |
| InChIKey | FHJHSNGZQYRXDX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)F)S(=O)(=O)C(F)F |
Computed by PubChem (NCBI)