Products 1228786-71-7
CAS 1228786-71-7 is the registry number for Tesmelefine-d4 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-(4-benzyl-2,3,5,6-tetradeuteriophenoxy)-N,N-diethylethanamine;hydrochloride (CAS 1228786-71-7) is a chemical compound with the molecular formula C19H26ClNO and a molecular weight of 323.9 g/mol. IUPAC name: 2-(4-benzyl-2,3,5,6-tetradeuteriophenoxy)-N,N-diethylethanamine;hydrochloride. InChIKey: TXLHNFOLHRXMAU-TYKHYFACSA-N.
| Molecular formula | C19H26ClNO |
|---|---|
| Molecular weight | 323.9 g/mol |
| IUPAC name | 2-(4-benzyl-2,3,5,6-tetradeuteriophenoxy)-N,N-diethylethanamine;hydrochloride |
| InChIKey | TXLHNFOLHRXMAU-TYKHYFACSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CC2=CC=CC=C2)[2H])[2H])OCCN(CC)CC)[2H].Cl |
Computed by PubChem (NCBI)