CAS 63526-63-6 is the registry number for alpha-D-4-Dimethylamino-1,2-diphenyl-3-methyl-2-butanol Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
(2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-ol;hydrochloride (CAS 63526-63-6) is a chemical compound with the molecular formula C19H26ClNO and a molecular weight of 319.9 g/mol. IUPAC name: (2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-ol;hydrochloride. InChIKey: WRHOJMZRFAKSSV-VWJDFLIZSA-N.
| Molecular formula | C19H26ClNO |
|---|---|
| Molecular weight | 319.9 g/mol |
| IUPAC name | (2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-ol;hydrochloride |
| InChIKey | WRHOJMZRFAKSSV-VWJDFLIZSA-N |
| SMILES | C[C@H](CN(C)C)[C@@](CC1=CC=CC=C1)(C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)