Products 349089-42-5

CAS 349089-42-5 appears in our catalog under these names: 2-Chloro-n,n-dicyclohexylbenzamide, 95%, 2-Chloro-N,N-dicyclohexylbenzamide, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 250mg, 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-chloro-N,N-dicyclohexylbenzamide (CAS 349089-42-5) is a chemical compound with the molecular formula C19H26ClNO and a molecular weight of 319.9 g/mol. IUPAC name: 2-chloro-N,N-dicyclohexylbenzamide. InChIKey: WHSMKKIHACOWQV-UHFFFAOYSA-N.

Identity
Molecular formulaC19H26ClNO
Molecular weight319.9 g/mol
IUPAC name2-chloro-N,N-dicyclohexylbenzamide
InChIKeyWHSMKKIHACOWQV-UHFFFAOYSA-N
SMILESC1CCC(CC1)N(C2CCCCC2)C(=O)C3=CC=CC=C3Cl

Computed by PubChem (NCBI)