Products 2749282-75-3

CAS 2749282-75-3 appears in our catalog under these names: 4–EA–NBOMe (hydrochloride), 4-EA-NBOMe (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.

Structural formula: {0} (CAS {1})

1-(4-ethylphenyl)-N-[(2-methoxyphenyl)methyl]propan-2-amine;hydrochloride (CAS 2749282-75-3) is a chemical compound with the molecular formula C19H26ClNO and a molecular weight of 319.9 g/mol. IUPAC name: 1-(4-ethylphenyl)-N-[(2-methoxyphenyl)methyl]propan-2-amine;hydrochloride. InChIKey: GTAJEYUQYRIMEN-UHFFFAOYSA-N.

Identity
Molecular formulaC19H26ClNO
Molecular weight319.9 g/mol
IUPAC name1-(4-ethylphenyl)-N-[(2-methoxyphenyl)methyl]propan-2-amine;hydrochloride
InChIKeyGTAJEYUQYRIMEN-UHFFFAOYSA-N
SMILESCCC1=CC=C(C=C1)CC(C)NCC2=CC=CC=C2OC.Cl

Computed by PubChem (NCBI)