CAS 1228879-34-2 appears in our catalog under these names: 1-(3-Bromophenyl)cyclobutanamine hydrochloride, 95%, 1–(3–bromophenyl)cyclobutan–1–amine hydrochloride, 1-(3-Bromophenyl)cyclobutanamine hydrochloride, 1-(3-Bromophenyl)cyclobutan-1-amine hydrochloride, 90%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
1-(3-bromophenyl)cyclobutan-1-amine;hydrochloride (CAS 1228879-34-2) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: 1-(3-bromophenyl)cyclobutan-1-amine;hydrochloride. InChIKey: LCTUCCMRTJSTME-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | 1-(3-bromophenyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | LCTUCCMRTJSTME-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=CC=C2)Br)N.Cl |
Computed by PubChem (NCBI)