Products 1228880-12-3

CAS 1228880-12-3 is the registry number for 3-Methyl-1-(pyridin-2-yl)butan-1-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

3-methyl-1-pyridin-2-ylbutan-1-amine;dihydrochloride (CAS 1228880-12-3) is a chemical compound with the molecular formula C10H18Cl2N2 and a molecular weight of 237.17 g/mol. IUPAC name: 3-methyl-1-pyridin-2-ylbutan-1-amine;dihydrochloride. InChIKey: VOBXDCVJBUYBPY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18Cl2N2
Molecular weight237.17 g/mol
IUPAC name3-methyl-1-pyridin-2-ylbutan-1-amine;dihydrochloride
InChIKeyVOBXDCVJBUYBPY-UHFFFAOYSA-N
SMILESCC(C)CC(C1=CC=CC=N1)N.Cl.Cl

Computed by PubChem (NCBI)