Products 2197062-41-0
CAS 2197062-41-0 appears in our catalog under these names: 2,2-Dimethyl-3-(pyridin-4-yl)propan-1-amine dihydrochloride, 95%, 2,2-Dimethyl-3-(pyridin-4-yl)propan-1-amine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2,2-dimethyl-3-pyridin-4-ylpropan-1-amine;dihydrochloride (CAS 2197062-41-0) is a chemical compound with the molecular formula C10H18Cl2N2 and a molecular weight of 237.17 g/mol. IUPAC name: 2,2-dimethyl-3-pyridin-4-ylpropan-1-amine;dihydrochloride. InChIKey: GSFMBWYAGUTHMS-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N2 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | 2,2-dimethyl-3-pyridin-4-ylpropan-1-amine;dihydrochloride |
| InChIKey | GSFMBWYAGUTHMS-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=NC=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)