CAS 122779-42-4 appears in our catalog under these names: (R)-4-(1-Aminoethyl)-N,N-dimethylaniline, 98%, (R)-4-(1-Aminoethyl)-n,n-dimethylaniline dihydrochloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 500mg, 100mg.
4-[(1R)-1-aminoethyl]-N,N-dimethylaniline;dihydrochloride (CAS 122779-42-4) is a chemical compound with the molecular formula C10H18Cl2N2 and a molecular weight of 237.17 g/mol. IUPAC name: 4-[(1R)-1-aminoethyl]-N,N-dimethylaniline;dihydrochloride. InChIKey: ISKBUIGUNHZFKY-YCBDHFTFSA-N.
| Molecular formula | C10H18Cl2N2 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | 4-[(1R)-1-aminoethyl]-N,N-dimethylaniline;dihydrochloride |
| InChIKey | ISKBUIGUNHZFKY-YCBDHFTFSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)N(C)C)N.Cl.Cl |
Computed by PubChem (NCBI)