Products 1909336-50-0
CAS 1909336-50-0 appears in our catalog under these names: 2-(1-Aminoethyl)-n,n-dimethylaniline dihydrochloride, 95%, 2-(1-Aminoethyl)-N,N-dimethylaniline diHCl. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 2,5g.
2-(1-aminoethyl)-N,N-dimethylaniline;dihydrochloride (CAS 1909336-50-0) is a chemical compound with the molecular formula C10H18Cl2N2 and a molecular weight of 237.17 g/mol. IUPAC name: 2-(1-aminoethyl)-N,N-dimethylaniline;dihydrochloride. InChIKey: IJOAYVXRAJDVDE-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N2 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | 2-(1-aminoethyl)-N,N-dimethylaniline;dihydrochloride |
| InChIKey | IJOAYVXRAJDVDE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1N(C)C)N.Cl.Cl |
Computed by PubChem (NCBI)