CAS 1228957-12-7 appears in our catalog under these names: 1-Bromo-4-(2-cbz-amino)vinylbenzene, 97%, Benzyl 4-bromostyrylcarbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
Benzyl N-[(E)-2-(4-bromophenyl)ethenyl]carbamate (CAS 1228957-12-7) is a chemical compound with the molecular formula C16H14BrNO2 and a molecular weight of 332.19 g/mol. IUPAC name: benzyl N-[(E)-2-(4-bromophenyl)ethenyl]carbamate. InChIKey: QTNNGECHOBOGOH-ZHACJKMWSA-N.
| Molecular formula | C16H14BrNO2 |
|---|---|
| Molecular weight | 332.19 g/mol |
| IUPAC name | benzyl N-[(E)-2-(4-bromophenyl)ethenyl]carbamate |
| InChIKey | QTNNGECHOBOGOH-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N/C=C/C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)