Products 92874-17-4
CAS 92874-17-4 appears in our catalog under these names: 6-Bromo-2-butyl-1H-benzo(de)isoquinoline-1,3(2H)-dione, 95-<97%, 6-Bromo-2-butyl-1H-benz[de]isoquinoline-1,3(2H)-dione, >98.0%(GC)(T), 6-Bromo-2-butyl-1H-benzo[de]isoquinoline-1,3(2H)-dione, 97%, 97%, 6-Bromo-2-butyl-1H-benzo[de]isoquinoline-1,3(2H)-dione, 95%. Offered by: Hoffman Fine Chemicals, TCI, Chemat, Ambeed. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.
6-bromo-2-butylbenzo[de]isoquinoline-1,3-dione (CAS 92874-17-4) is a chemical compound with the molecular formula C16H14BrNO2 and a molecular weight of 332.19 g/mol. IUPAC name: 6-bromo-2-butylbenzo[de]isoquinoline-1,3-dione. InChIKey: LXKQLQDJZKQFQG-UHFFFAOYSA-N.
| Molecular formula | C16H14BrNO2 |
|---|---|
| Molecular weight | 332.19 g/mol |
| IUPAC name | 6-bromo-2-butylbenzo[de]isoquinoline-1,3-dione |
| InChIKey | LXKQLQDJZKQFQG-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=C3C(=C(C=C2)Br)C=CC=C3C1=O |
Computed by PubChem (NCBI)