CAS 374911-94-1 is the registry number for 1-[3-(6-Bromo-2h-1,3-benzoxazin-3(4h)-yl)phenyl]ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[3-(6-bromo-2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]ethanone (CAS 374911-94-1) is a chemical compound with the molecular formula C16H14BrNO2 and a molecular weight of 332.19 g/mol. IUPAC name: 1-[3-(6-bromo-2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]ethanone. InChIKey: UEWLJQVWEQZRTE-UHFFFAOYSA-N.
| Molecular formula | C16H14BrNO2 |
|---|---|
| Molecular weight | 332.19 g/mol |
| IUPAC name | 1-[3-(6-bromo-2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]ethanone |
| InChIKey | UEWLJQVWEQZRTE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)N2CC3=C(C=CC(=C3)Br)OC2 |
Computed by PubChem (NCBI)