CAS 2142337-44-6 is the registry number for Benzyl 4-bromoisoindoline-2-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 4-bromo-1,3-dihydroisoindole-2-carboxylate (CAS 2142337-44-6) is a chemical compound with the molecular formula C16H14BrNO2 and a molecular weight of 332.19 g/mol. IUPAC name: benzyl 4-bromo-1,3-dihydroisoindole-2-carboxylate. InChIKey: PRPJUPFVEZFEQA-UHFFFAOYSA-N.
| Molecular formula | C16H14BrNO2 |
|---|---|
| Molecular weight | 332.19 g/mol |
| IUPAC name | benzyl 4-bromo-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | PRPJUPFVEZFEQA-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1C(=O)OCC3=CC=CC=C3)C(=CC=C2)Br |
Computed by PubChem (NCBI)