CAS 1229-55-6 appears in our catalog under these names: Sudan Red G, Sudan R, >95% (HPLC), Sudan red G, Sudan Red G (C.I. 12150), 95.00%, Sudan R. Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC, GLPBio, Chemat. Available pack sizes: on request, 100mg, 1g, 25g, 100g, 5g, 2000g, 1000g.
1-[(2-methoxyphenyl)diazenyl]naphthalen-2-ol (CAS 1229-55-6) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: 1-[(2-methoxyphenyl)diazenyl]naphthalen-2-ol. InChIKey: ALLOLPOYFRLCCX-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-[(2-methoxyphenyl)diazenyl]naphthalen-2-ol |
| InChIKey | ALLOLPOYFRLCCX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N=NC2=C(C=CC3=CC=CC=C32)O |
Computed by PubChem (NCBI)