Products 1229028-63-0
CAS 1229028-63-0 is the registry number for FCH-2296413, 96.37%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg, 50 mg, 100 mg.
7-(2H-tetrazol-5-yl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene (CAS 1229028-63-0) is a chemical compound with the molecular formula C8H8N6 and a molecular weight of 188.19 g/mol. IUPAC name: 7-(2H-tetrazol-5-yl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene. InChIKey: DKSPRNJUDCWTID-UHFFFAOYSA-N.
| Molecular formula | C8H8N6 |
|---|---|
| Molecular weight | 188.19 g/mol |
| IUPAC name | 7-(2H-tetrazol-5-yl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene |
| InChIKey | DKSPRNJUDCWTID-UHFFFAOYSA-N |
| SMILES | C1C2C1C3=C(C2)C(=NN3)C4=NNN=N4 |
Computed by PubChem (NCBI)
Synonyms:
compound (+)17a [PMID: 20363624]