CAS 18020-61-6 is the registry number for 6-(Pyridin-3-yl)-1,3,5-triazine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-pyridin-3-yl-1,3,5-triazine-2,4-diamine (CAS 18020-61-6) is a chemical compound with the molecular formula C8H8N6 and a molecular weight of 188.19 g/mol. IUPAC name: 6-pyridin-3-yl-1,3,5-triazine-2,4-diamine. InChIKey: FVYBKHNQSAHYGJ-UHFFFAOYSA-N.
| Molecular formula | C8H8N6 |
|---|---|
| Molecular weight | 188.19 g/mol |
| IUPAC name | 6-pyridin-3-yl-1,3,5-triazine-2,4-diamine |
| InChIKey | FVYBKHNQSAHYGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC(=NC(=N2)N)N |
Computed by PubChem (NCBI)