CAS 1272069-02-9 appears in our catalog under these names: 1,3-Dimethyl-5-(1H-1,2,4-triazol-1-yl)-1H-pyrazole-4-carbonitrile, 95%, 1,3-Dimethyl-5-(1H-1,2,4-triazol-1-yl)-1H-pyrazole-4-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1,3-dimethyl-5-(1,2,4-triazol-1-yl)pyrazole-4-carbonitrile (CAS 1272069-02-9) is a chemical compound with the molecular formula C8H8N6 and a molecular weight of 188.19 g/mol. IUPAC name: 1,3-dimethyl-5-(1,2,4-triazol-1-yl)pyrazole-4-carbonitrile. InChIKey: YKKAXKGJTRGSFT-UHFFFAOYSA-N.
| Molecular formula | C8H8N6 |
|---|---|
| Molecular weight | 188.19 g/mol |
| IUPAC name | 1,3-dimethyl-5-(1,2,4-triazol-1-yl)pyrazole-4-carbonitrile |
| InChIKey | YKKAXKGJTRGSFT-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C#N)N2C=NC=N2)C |
Computed by PubChem (NCBI)