Products 155791-29-0
CAS 155791-29-0 is the registry number for 1-(1-Azidoethyl)-1H-1,2,3-benzotriazole, 90%. Offered by: Fluorochem. Available pack sizes: 1g.
1-(1-azidoethyl)benzotriazole (CAS 155791-29-0) is a chemical compound with the molecular formula C8H8N6 and a molecular weight of 188.19 g/mol. IUPAC name: 1-(1-azidoethyl)benzotriazole. InChIKey: VYERLAVEQFCLRW-UHFFFAOYSA-N.
| Molecular formula | C8H8N6 |
|---|---|
| Molecular weight | 188.19 g/mol |
| IUPAC name | 1-(1-azidoethyl)benzotriazole |
| InChIKey | VYERLAVEQFCLRW-UHFFFAOYSA-N |
| SMILES | CC(N=[N+]=[N-])N1C2=CC=CC=C2N=N1 |
Computed by PubChem (NCBI)