Products 1229591-56-3
CAS 1229591-56-3 appears in our catalog under these names: UCPH–102, UCPH-102, UCPH-102, 99.20%, Ucph-102 >= 98 % HPLC. Offered by: GLPBio, Biosynth, MedChemExpress, Sigma-Aldrich. Available pack sizes: 10mg, 5mg, 50mg, 25mg, 100mg, 100 mg, 50 mg, 25 mg.
2-amino-4-methyl-7-naphthalen-1-yl-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile (CAS 1229591-56-3) is a chemical compound with the molecular formula C21H18N2O2 and a molecular weight of 330.4 g/mol. IUPAC name: 2-amino-4-methyl-7-naphthalen-1-yl-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile. InChIKey: XZQMHUGTNOOYFX-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 2-amino-4-methyl-7-naphthalen-1-yl-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
| InChIKey | XZQMHUGTNOOYFX-UHFFFAOYSA-N |
| SMILES | CC1C(=C(OC2=C1C(=O)CC(C2)C3=CC=CC4=CC=CC=C43)N)C#N |
Computed by PubChem (NCBI)