Products 122978-33-0
CAS 122978-33-0 is the registry number for 4-Chloro-7-methoxy-2-oxo-2H-chromene-3-carbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-7-methoxy-2-oxochromene-3-carbaldehyde (CAS 122978-33-0) is a chemical compound with the molecular formula C11H7ClO4 and a molecular weight of 238.62 g/mol. IUPAC name: 4-chloro-7-methoxy-2-oxochromene-3-carbaldehyde. InChIKey: ISMYIGLBVUWLBI-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO4 |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | 4-chloro-7-methoxy-2-oxochromene-3-carbaldehyde |
| InChIKey | ISMYIGLBVUWLBI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=C(C(=O)O2)C=O)Cl |
Computed by PubChem (NCBI)