Products 262590-94-3

CAS 262590-94-3 is the registry number for 6-Chloro-7-methylchromone-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.

Structural formula: {0} (CAS {1})

6-chloro-7-methyl-4-oxochromene-2-carboxylic acid (CAS 262590-94-3) is a chemical compound with the molecular formula C11H7ClO4 and a molecular weight of 238.62 g/mol. IUPAC name: 6-chloro-7-methyl-4-oxochromene-2-carboxylic acid. InChIKey: UAOFSXACYWSXCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7ClO4
Molecular weight238.62 g/mol
IUPAC name6-chloro-7-methyl-4-oxochromene-2-carboxylic acid
InChIKeyUAOFSXACYWSXCJ-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1Cl)C(=O)C=C(O2)C(=O)O

Computed by PubChem (NCBI)