Products 1239779-74-8
CAS 1239779-74-8 is the registry number for 6-Chloro-3-methyl-4-oxo-4H-chromene-2-carboxylic Acid, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-chloro-3-methyl-4-oxochromene-2-carboxylic acid (CAS 1239779-74-8) is a chemical compound with the molecular formula C11H7ClO4 and a molecular weight of 238.62 g/mol. IUPAC name: 6-chloro-3-methyl-4-oxochromene-2-carboxylic acid. InChIKey: VINQIFRNULMLLI-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO4 |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | 6-chloro-3-methyl-4-oxochromene-2-carboxylic acid |
| InChIKey | VINQIFRNULMLLI-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C(C1=O)C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)