CAS 65120-69-6 appears in our catalog under these names: 2-Chloro-8-hydroxy-6-methoxynaphthalene-1,4-dione, 95%, 2–Chloro–8–hydroxy–6–methoxynaphthalene–1,4–dione, 2-Chloro-8-hydroxy-6-methoxynaphthalene-1,4-dione, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-chloro-8-hydroxy-6-methoxynaphthalene-1,4-dione (CAS 65120-69-6) is a chemical compound with the molecular formula C11H7ClO4 and a molecular weight of 238.62 g/mol. IUPAC name: 2-chloro-8-hydroxy-6-methoxynaphthalene-1,4-dione. InChIKey: CEQWFJADWPVYTH-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO4 |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | 2-chloro-8-hydroxy-6-methoxynaphthalene-1,4-dione |
| InChIKey | CEQWFJADWPVYTH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)O)C(=O)C(=CC2=O)Cl |
Computed by PubChem (NCBI)