Products 123134-23-6
CAS 123134-23-6 is the registry number for 1-O-Caffeoylglycerol. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3-dihydroxypropyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (CAS 123134-23-6) is a chemical compound with the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. IUPAC name: 2,3-dihydroxypropyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate. InChIKey: NOHROAYVCRHDHO-DUXPYHPUSA-N.
| Molecular formula | C12H14O6 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 2,3-dihydroxypropyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| InChIKey | NOHROAYVCRHDHO-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)OCC(CO)O)O)O |
Computed by PubChem (NCBI)