CAS 1231953-54-0 is the registry number for (5-(Thiophen-2-yl)-1H-pyrazol-3-yl)methanamine dihydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
(3-thiophen-2-yl-1H-pyrazol-5-yl)methanamine;dihydrochloride (CAS 1231953-54-0) is a chemical compound with the molecular formula C8H11Cl2N3S and a molecular weight of 252.16 g/mol. IUPAC name: (3-thiophen-2-yl-1H-pyrazol-5-yl)methanamine;dihydrochloride. InChIKey: JENFNKGNKSIHJE-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3S |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | (3-thiophen-2-yl-1H-pyrazol-5-yl)methanamine;dihydrochloride |
| InChIKey | JENFNKGNKSIHJE-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NNC(=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)