CAS 2736598-11-9 is the registry number for 3-(4,6-Dichloro-2-(methylthio)pyrimidin-5-yl)propan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)propan-1-amine (CAS 2736598-11-9) is a chemical compound with the molecular formula C8H11Cl2N3S and a molecular weight of 252.16 g/mol. IUPAC name: 3-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)propan-1-amine. InChIKey: RQCTWKKSDYRNDW-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3S |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | 3-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)propan-1-amine |
| InChIKey | RQCTWKKSDYRNDW-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=C(C(=N1)Cl)CCCN)Cl |
Computed by PubChem (NCBI)