CAS 1252444-09-9 appears in our catalog under these names: N-(4,5-Dihydro-1,3-thiazol-2-yl)pyridin-3-amine dihydrochloride, 95%, N-(4,5-Dihydro-1,3-thiazol-2-yl)pyridin-3-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine;dihydrochloride (CAS 1252444-09-9) is a chemical compound with the molecular formula C8H11Cl2N3S and a molecular weight of 252.16 g/mol. IUPAC name: N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine;dihydrochloride. InChIKey: GQLFJYOBEHNMIE-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3S |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine;dihydrochloride |
| InChIKey | GQLFJYOBEHNMIE-UHFFFAOYSA-N |
| SMILES | C1CSC(=N1)NC2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)