CAS 1373253-23-6 appears in our catalog under these names: 6-Hydrazino-2-methyl-1,3-benzothiazole dihydrochloride, 95%, 6-Hydrazinyl-2-methylbenzo(d)thiazole dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
(2-methyl-1,3-benzothiazol-6-yl)hydrazine;dihydrochloride (CAS 1373253-23-6) is a chemical compound with the molecular formula C8H11Cl2N3S and a molecular weight of 252.16 g/mol. IUPAC name: (2-methyl-1,3-benzothiazol-6-yl)hydrazine;dihydrochloride. InChIKey: WZEMFRGNVGBUNQ-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3S |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | (2-methyl-1,3-benzothiazol-6-yl)hydrazine;dihydrochloride |
| InChIKey | WZEMFRGNVGBUNQ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C=C2)NN.Cl.Cl |
Computed by PubChem (NCBI)