CAS 1232028-11-3 appears in our catalog under these names: 5–(2–Nitrophenyl)isoxazole–3–carboxylic Acid, 5-(2-Nitrophenyl)isoxazole-3-carboxylic acid, 5-(2-Nitrophenyl)isoxazole-3-carboxylic acid, 95%, 5-(2-Nitrophenyl)isoxazole-3-carboxylic acid, >97%, 5-(2-Nitrophenyl)isoxazole-3-carboxylic Acid, >97%, >97%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg.
5-(2-nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS 1232028-11-3) is a chemical compound with the molecular formula C10H6N2O5 and a molecular weight of 234.16 g/mol. IUPAC name: 5-(2-nitrophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: MMLOMUSIMLNSCH-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O5 |
|---|---|
| Molecular weight | 234.16 g/mol |
| IUPAC name | 5-(2-nitrophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | MMLOMUSIMLNSCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=NO2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)