Products 33282-25-6
CAS 33282-25-6 appears in our catalog under these names: 5-(4-Nitrophenyl)isoxazole-3-carboxylic acid, 95%, 5–(4–Nitrophenyl)isoxazole–3–carboxylic Acid, 5-(4-Nitrophenyl)isoxazole-3-carboxylic acid, >97%. Offered by: Combi-blocks, GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
5-(4-nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS 33282-25-6) is a chemical compound with the molecular formula C10H6N2O5 and a molecular weight of 234.16 g/mol. IUPAC name: 5-(4-nitrophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: GBRSPKXOFRTAHS-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O5 |
|---|---|
| Molecular weight | 234.16 g/mol |
| IUPAC name | 5-(4-nitrophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | GBRSPKXOFRTAHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)