CAS 199601-80-4 appears in our catalog under these names: 5–(3–Nitrophenyl)isoxazole–3–carboxylic Acid, 5-(3-Nitrophenyl)isoxazole-3-carboxylic acid 97%, 5-(3-Nitrophenyl)-3-isoxazolecarboxylic acid, 97%, 97%, 5-(3-Nitrophenyl)isoxazole-3-carboxylic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
5-(3-nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS 199601-80-4) is a chemical compound with the molecular formula C10H6N2O5 and a molecular weight of 234.16 g/mol. IUPAC name: 5-(3-nitrophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: UADDGBIOHFWIDV-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O5 |
|---|---|
| Molecular weight | 234.16 g/mol |
| IUPAC name | 5-(3-nitrophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | UADDGBIOHFWIDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)