Products 951885-28-2

CAS 951885-28-2 is the registry number for 5-(3-Nitrophenyl)oxazole-4-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

5-(3-nitrophenyl)-1,3-oxazole-4-carboxylic acid (CAS 951885-28-2) is a chemical compound with the molecular formula C10H6N2O5 and a molecular weight of 234.16 g/mol. IUPAC name: 5-(3-nitrophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: TXIIRMPKHMVIGN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6N2O5
Molecular weight234.16 g/mol
IUPAC name5-(3-nitrophenyl)-1,3-oxazole-4-carboxylic acid
InChIKeyTXIIRMPKHMVIGN-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)[N+](=O)[O-])C2=C(N=CO2)C(=O)O

Computed by PubChem (NCBI)