CAS 951885-28-2 is the registry number for 5-(3-Nitrophenyl)oxazole-4-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
5-(3-nitrophenyl)-1,3-oxazole-4-carboxylic acid (CAS 951885-28-2) is a chemical compound with the molecular formula C10H6N2O5 and a molecular weight of 234.16 g/mol. IUPAC name: 5-(3-nitrophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: TXIIRMPKHMVIGN-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O5 |
|---|---|
| Molecular weight | 234.16 g/mol |
| IUPAC name | 5-(3-nitrophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | TXIIRMPKHMVIGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)