CAS 123237-62-7 appears in our catalog under these names: tert–Butyldimethylsilyl (S)–(+)–glycidyl ether, tert-Butyldimethylsilyl (S)-Glycidyl Ether, >95.0%(GC), (S)-Glycidoxy-t-butyldimethylsilane, 98%, tert-Butyldimethylsilyl (S)-(+)-glycidyl ether 95%, tert-Butyldimethylsilyl (S)-(+)-glycidyl ether, 95%. Offered by: GLPBio, TCI, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 5ml, 100g, 500g, 1000g, 1g, 1kg.
Tert-butyl-dimethyl-[[(2S)-oxiran-2-yl]methoxy]silane (CAS 123237-62-7) is a chemical compound with the molecular formula C9H20O2Si and a molecular weight of 188.34 g/mol. IUPAC name: tert-butyl-dimethyl-[[(2S)-oxiran-2-yl]methoxy]silane. InChIKey: YANSSVVGZPNSKD-QMMMGPOBSA-N.
| Molecular formula | C9H20O2Si |
|---|---|
| Molecular weight | 188.34 g/mol |
| IUPAC name | tert-butyl-dimethyl-[[(2S)-oxiran-2-yl]methoxy]silane |
| InChIKey | YANSSVVGZPNSKD-QMMMGPOBSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CO1 |
Computed by PubChem (NCBI)