CAS 87727-28-4 appears in our catalog under these names: (S)-2-(tert-Butyldimethylsilyloxy)propanal 95%, (S)-2-(tert-Butyldimethylsilyloxy)propanal, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-[tert-butyl(dimethyl)silyl]oxypropanal (CAS 87727-28-4) is a chemical compound with the molecular formula C9H20O2Si and a molecular weight of 188.34 g/mol. IUPAC name: (2S)-2-[tert-butyl(dimethyl)silyl]oxypropanal. InChIKey: YMIIHJBTQLZXBV-QMMMGPOBSA-N.
| Molecular formula | C9H20O2Si |
|---|---|
| Molecular weight | 188.34 g/mol |
| IUPAC name | (2S)-2-[tert-butyl(dimethyl)silyl]oxypropanal |
| InChIKey | YMIIHJBTQLZXBV-QMMMGPOBSA-N |
| SMILES | C[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)