CAS 78906-15-7 appears in our catalog under these names: tert-Butyldimethylsilyl glycidyl ether, 95%, TERT-BUTYLMETHYLSILYL GLYCIDYL ETHER, &, tert-Butyldimethylsilyl glycidyl ether, 95%, 95%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g.
Tert-butyl-dimethyl-(oxiran-2-ylmethoxy)silane (CAS 78906-15-7) is a chemical compound with the molecular formula C9H20O2Si and a molecular weight of 188.34 g/mol. IUPAC name: tert-butyl-dimethyl-(oxiran-2-ylmethoxy)silane. InChIKey: YANSSVVGZPNSKD-UHFFFAOYSA-N.
| Molecular formula | C9H20O2Si |
|---|---|
| Molecular weight | 188.34 g/mol |
| IUPAC name | tert-butyl-dimethyl-(oxiran-2-ylmethoxy)silane |
| InChIKey | YANSSVVGZPNSKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CO1 |
Computed by PubChem (NCBI)