Products 41108-81-0
CAS 41108-81-0 is the registry number for tert-Butyl (Trimethylsilyl)acetate. Offered by: TRC. Available pack sizes: 10g, 2,5g, 25g.
Tert-butyl 2-trimethylsilylacetate (CAS 41108-81-0) is a chemical compound with the molecular formula C9H20O2Si and a molecular weight of 188.34 g/mol. IUPAC name: tert-butyl 2-trimethylsilylacetate. InChIKey: HOHBQWITMXOSOW-UHFFFAOYSA-N.
| Molecular formula | C9H20O2Si |
|---|---|
| Molecular weight | 188.34 g/mol |
| IUPAC name | tert-butyl 2-trimethylsilylacetate |
| InChIKey | HOHBQWITMXOSOW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C[Si](C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
1,1-Dimethylethyl trimethylsilylacetate, tert-Butyl trimethylsilylacetate, tert-butyl 2-trimethylsilylacetate, TERT-BUTYL (TRIMETHYLSILYL)ACETATE, 1,1-Dimethylethyl 2-(trimethylsilyl)acetate, t-butyltrimethylsilylacetate, t-butyl trimethylsilylacetate, Acetic acid, (trimethylsilyl)-, 1,1-dimethylethyl ester, tert-Butyl trimethylsilylacetate, >=95.0% (GC)