CAS 1232407-19-0 is the registry number for Clopidogrel Impurity 45. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-bromo-3-methoxyphenyl)ethanone (CAS 1232407-19-0) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 1-(2-bromo-3-methoxyphenyl)ethanone. InChIKey: HULDTYWPYADGGL-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 1-(2-bromo-3-methoxyphenyl)ethanone |
| InChIKey | HULDTYWPYADGGL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC=C1)OC)Br |
Computed by PubChem (NCBI)