CAS 123334-75-8 is the registry number for 2'–Fluoro–2'–deoxy–arabinofuranosyl–adenosine. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (CAS 123334-75-8) is a chemical compound with the molecular formula C10H12FN5O3 and a molecular weight of 269.23 g/mol. IUPAC name: (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol. InChIKey: ZGYYPTJWJBEXBC-XEVJOGTHSA-N.
| Molecular formula | C10H12FN5O3 |
|---|---|
| Molecular weight | 269.23 g/mol |
| IUPAC name | (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | ZGYYPTJWJBEXBC-XEVJOGTHSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@H]([C@H](O3)CO)O)F)N |
Computed by PubChem (NCBI)