CAS 1612192-04-7 is the registry number for 9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-9H-purin-2-amine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,4S,5R)-2-(2-aminopurin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-ol (CAS 1612192-04-7) is a chemical compound with the molecular formula C10H12FN5O3 and a molecular weight of 269.23 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(2-aminopurin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-ol. InChIKey: SARAHSXQPRQRAM-JXOAFFINSA-N.
| Molecular formula | C10H12FN5O3 |
|---|---|
| Molecular weight | 269.23 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(2-aminopurin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-ol |
| InChIKey | SARAHSXQPRQRAM-JXOAFFINSA-N |
| SMILES | C1=C2C(=NC(=N1)N)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)F)O |
Computed by PubChem (NCBI)