Products 75059-22-2
CAS 75059-22-2 appears in our catalog under these names: 3'-Deoxy-3'-fluoroadenosine, 10 mg, 3'-Deoxy-3'-fluoroadenosine, 95%, 3'-Deoxy-3'-fluoroadenosine/ 99.84% (existing batch purity), 3'–Deoxy–3'–fluoroadenosine, 3'-Deoxy-3'-fluoroadenosine. Offered by: Roth, Combi-blocks, TargetMol, GLPBio, Biosynth. Available pack sizes: 10mg, 100mg, 5mg, 25mg, 50mg, 250mg, 10 mg, 100 mg.
(2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-ol (CAS 75059-22-2) is a chemical compound with the molecular formula C10H12FN5O3 and a molecular weight of 269.23 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-ol. InChIKey: QCDAWXDDXYQEJJ-QYYRPYCUSA-N.
| Molecular formula | C10H12FN5O3 |
|---|---|
| Molecular weight | 269.23 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-ol |
| InChIKey | QCDAWXDDXYQEJJ-QYYRPYCUSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)F)O)N |
Computed by PubChem (NCBI)