CAS 64183-27-3 appears in our catalog under these names: 2'-Deoxy-2'-fluoroadenosine, min. 95 %, 1 g, 2'-Fluoro-2'-deoxyadenosine, 95%, 2'-Fluoro-2'-deoxyadenosine, >95% (HPLC), 2′–Deoxy–2′–fluoroadenosine, 2'-Fluoro-2'-Deoxyadenosine. Offered by: Roth, Combi-blocks, TRC, GLPBio, TargetMol. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 50mg, 10g, 25g.
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (CAS 64183-27-3) is a chemical compound with the molecular formula C10H12FN5O3 and a molecular weight of 269.23 g/mol. IUPAC name: (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol. InChIKey: ZGYYPTJWJBEXBC-QYYRPYCUSA-N.
| Molecular formula | C10H12FN5O3 |
|---|---|
| Molecular weight | 269.23 g/mol |
| IUPAC name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | ZGYYPTJWJBEXBC-QYYRPYCUSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)F)N |
Computed by PubChem (NCBI)