CAS 123345-20-0 appears in our catalog under these names: 1-(4-Bromophenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid, 95%, 1-(4-Bromophenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(4-bromophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid (CAS 123345-20-0) is a chemical compound with the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. IUPAC name: 1-(4-bromophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid. InChIKey: DVJDROZKTORELN-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O2 |
|---|---|
| Molecular weight | 321.17 g/mol |
| IUPAC name | 1-(4-bromophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| InChIKey | DVJDROZKTORELN-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2C3=CC=C(C=C3)Br)C(=O)O |
Computed by PubChem (NCBI)