Products 1258391-91-1
CAS 1258391-91-1 is the registry number for Ethyl 3-(5-amino-6-bromopyridin-2-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
Ethyl 3-(5-amino-6-bromo-2-pyridinyl)benzoate (CAS 1258391-91-1) is a chemical compound with the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. IUPAC name: ethyl 3-(5-amino-6-bromo-2-pyridinyl)benzoate. InChIKey: UYRQCWXXUCZJBD-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O2 |
|---|---|
| Molecular weight | 321.17 g/mol |
| IUPAC name | ethyl 3-(5-amino-6-bromo-2-pyridinyl)benzoate |
| InChIKey | UYRQCWXXUCZJBD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC(=C1)C2=NC(=C(C=C2)N)Br |
Computed by PubChem (NCBI)