Products 951885-02-2
CAS 951885-02-2 appears in our catalog under these names: N-(4-Methoxybenzyl) 5-bromopicolinamide, 98%, N-(4-Methoxybenzyl) 5-bromopicolinamide, 98%, 98%, 5-Bromo-N-(4-methoxybenzyl)picolinamide, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g.
5-bromo-N-[(4-methoxyphenyl)methyl]pyridine-2-carboxamide (CAS 951885-02-2) is a chemical compound with the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. IUPAC name: 5-bromo-N-[(4-methoxyphenyl)methyl]pyridine-2-carboxamide. InChIKey: WDOMBIXVPWZYFE-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O2 |
|---|---|
| Molecular weight | 321.17 g/mol |
| IUPAC name | 5-bromo-N-[(4-methoxyphenyl)methyl]pyridine-2-carboxamide |
| InChIKey | WDOMBIXVPWZYFE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC(=O)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)