CAS 1375068-61-3 is the registry number for Benzyl N-(3-amino-5-bromophenyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Benzyl N-(3-amino-5-bromophenyl)carbamate (CAS 1375068-61-3) is a chemical compound with the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. IUPAC name: benzyl N-(3-amino-5-bromophenyl)carbamate. InChIKey: FZKVNVIPLOYJJQ-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O2 |
|---|---|
| Molecular weight | 321.17 g/mol |
| IUPAC name | benzyl N-(3-amino-5-bromophenyl)carbamate |
| InChIKey | FZKVNVIPLOYJJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=CC(=C2)N)Br |
Computed by PubChem (NCBI)