Products 1233706-89-2
CAS 1233706-89-2 appears in our catalog under these names: CAY10641, cPLA2α-IN-derivative 1. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 50 mg, 5 mg, 1 mg, 25 mg.
1-[2-hydroxy-3-(4-phenoxyphenoxy)propyl]-3-(2-methylpropanoyl)indole-5-carboxylic acid (CAS 1233706-89-2) is a chemical compound with the molecular formula C28H27NO6 and a molecular weight of 473.5 g/mol. IUPAC name: 1-[2-hydroxy-3-(4-phenoxyphenoxy)propyl]-3-(2-methylpropanoyl)indole-5-carboxylic acid. InChIKey: BOEJDYFVYZETDG-UHFFFAOYSA-N.
| Molecular formula | C28H27NO6 |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | 1-[2-hydroxy-3-(4-phenoxyphenoxy)propyl]-3-(2-methylpropanoyl)indole-5-carboxylic acid |
| InChIKey | BOEJDYFVYZETDG-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=CN(C2=C1C=C(C=C2)C(=O)O)CC(COC3=CC=C(C=C3)OC4=CC=CC=C4)O |
Computed by PubChem (NCBI)
Synonyms:
cPLA2|A-IN-derivative 1, orb1692548