Products 447415-26-1
CAS 447415-26-1 appears in our catalog under these names: NH–3, NH-3, NH-3, 99.41%, NH-3, 98%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
2-[4-[[4-hydroxy-3-[2-(4-nitrophenyl)ethynyl]-5-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid (CAS 447415-26-1) is a chemical compound with the molecular formula C28H27NO6 and a molecular weight of 473.5 g/mol. IUPAC name: 2-[4-[[4-hydroxy-3-[2-(4-nitrophenyl)ethynyl]-5-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid. InChIKey: IXMROOKFPWGDGF-UHFFFAOYSA-N.
| Molecular formula | C28H27NO6 |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | 2-[4-[[4-hydroxy-3-[2-(4-nitrophenyl)ethynyl]-5-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid |
| InChIKey | IXMROOKFPWGDGF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CC2=CC(=C(C(=C2)C(C)C)O)C#CC3=CC=C(C=C3)[N+](=O)[O-])C)OCC(=O)O |
Computed by PubChem (NCBI)